C14H12BrF3N2O5 — CID 87886321
methyl 3-bromo-4-[[(E)-but-2-enyl]-(2,2,2-trifluoroacetyl)amino]-5-nitrobenzoate (PubChem CID 87886321) has the molecular formula C14H12BrF3N2O5 and a molecular weight of 425.16 g/mol. Its IUPAC name is methyl 3-bromo-4-[[(E)-but-2-enyl]-(2,2,2-trifluoroacetyl)amino]-5-nitrobenzoate.
| Compound Name | methyl 3-bromo-4-[[(E)-but-2-enyl]-(2,2,2-trifluoroacetyl)amino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 87886321 |
| Molecular Formula | C14H12BrF3N2O5 |
| Molecular Weight | 425.16 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | methyl 3-bromo-4-[[(E)-but-2-enyl]-(2,2,2-trifluoroacetyl)amino]-5-nitrobenzoate |
| SMILES | C/C=C/CN(C(=O)C(F)(F)F)c1c(Br)cc(C(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12BrF3N2O5/c1-3-4-5-19(13(22)14(16,17)18)11-9(15)6-8(12(21)25-2)7-10(11)20(23)24/h3-4,6-7H,5H2,1-2H3/b4-3+ |
| InChIKey | KWHVUTMCFKZCDJ-ONEGZZNKSA-N |
| XLogP | 3.62 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|