C10H9N3OS — CID 1245805
N-(5-methyl-1,3-thiazol-2-yl)pyridine-4-carboxamide (PubChem CID 1245805) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 1245805 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)pyridine-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2ccncc2)s1 |
| InChI | InChI=1S/C10H9N3OS/c1-7-6-12-10(15-7)13-9(14)8-2-4-11-5-3-8/h2-6H,1H3,(H,12,13,14) |
| InChIKey | XQJPDOGUWRFCHN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |