C18H24N6O2S — CID 124584411
tert-butyl (2S,3S)-3-carbamothioyl-2-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)pyrrolidine-1-carboxylate (PubChem CID 124584411) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-carbamothioyl-2-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-carbamothioyl-2-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124584411 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | tert-butyl (2S,3S)-3-carbamothioyl-2-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)pyrrolidine-1-carboxylate |
| SMILES | Cc1cc([C@@H]2[C@@H](C(N)=S)CCN2C(=O)OC(C)(C)C)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C18H24N6O2S/c1-11-9-13(22-16(21-11)23-8-6-20-10-23)14-12(15(19)27)5-7-24(14)17(25)26-18(2,3)4/h6,8-10,12,14H,5,7H2,1-4H3,(H2,19,27)/t12-,14-/m0/s1 |
| InChIKey | ARMDGXYDZCFWHB-JSGCOSHPSA-N |
| XLogP | 2.55 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|