C15H27NO2S2 — CID 124588083
1-[(3S)-3-methylsulfanylazepan-1-yl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]ethanone (PubChem CID 124588083) has the molecular formula C15H27NO2S2 and a molecular weight of 317.52 g/mol. Its IUPAC name is 1-[(3S)-3-methylsulfanylazepan-1-yl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]ethanone.
| Compound Name | 1-[(3S)-3-methylsulfanylazepan-1-yl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]ethanone |
|---|---|
| PubChem CID | 124588083 |
| Molecular Formula | C15H27NO2S2 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-[(3S)-3-methylsulfanylazepan-1-yl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]ethanone |
| SMILES | CS[C@H]1CCCCN(C(=O)CSC[C@@H]2CCCCO2)C1 |
| InChI | InChI=1S/C15H27NO2S2/c1-19-14-7-2-4-8-16(10-14)15(17)12-20-11-13-6-3-5-9-18-13/h13-14H,2-12H2,1H3/t13-,14-/m0/s1 |
| InChIKey | OFMSEBZZCSWUBA-KBPBESRZSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |