C13H17FN2O3 — CID 124588211
(3R)-N-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]morpholine-3-carboxamide (PubChem CID 124588211) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is (3R)-N-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]morpholine-3-carboxamide.
| Compound Name | (3R)-N-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 124588211 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3R)-N-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]morpholine-3-carboxamide |
| SMILES | O=C(NC[C@H](O)c1ccccc1F)[C@H]1COCCN1 |
| InChI | InChI=1S/C13H17FN2O3/c14-10-4-2-1-3-9(10)12(17)7-16-13(18)11-8-19-6-5-15-11/h1-4,11-12,15,17H,5-8H2,(H,16,18)/t11-,12+/m1/s1 |
| InChIKey | ZBSURBPWZRIOMJ-NEPJUHHUSA-N |
| XLogP | -0.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |