C20H24N2O2 — CID 124699410
(3R)-N-[(2S)-2,3-diphenylpropyl]morpholine-3-carboxamide (PubChem CID 124699410) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3R)-N-[(2S)-2,3-diphenylpropyl]morpholine-3-carboxamide.
| Compound Name | (3R)-N-[(2S)-2,3-diphenylpropyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 124699410 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (3R)-N-[(2S)-2,3-diphenylpropyl]morpholine-3-carboxamide |
| SMILES | O=C(NC[C@@H](Cc1ccccc1)c1ccccc1)[C@H]1COCCN1 |
| InChI | InChI=1S/C20H24N2O2/c23-20(19-15-24-12-11-21-19)22-14-18(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-10,18-19,21H,11-15H2,(H,22,23)/t18-,19-/m1/s1 |
| InChIKey | XLYNTLGIVOSTFL-RTBURBONSA-N |
| XLogP | 2.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |