C17H21N5O3 — CID 124588257
(3S)-3-[(1-methylimidazol-2-yl)methyl]-N-(4-nitrophenyl)piperidine-1-carboxamide (PubChem CID 124588257) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (3S)-3-[(1-methylimidazol-2-yl)methyl]-N-(4-nitrophenyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[(1-methylimidazol-2-yl)methyl]-N-(4-nitrophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 124588257 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (3S)-3-[(1-methylimidazol-2-yl)methyl]-N-(4-nitrophenyl)piperidine-1-carboxamide |
| SMILES | Cn1ccnc1C[C@@H]1CCCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H21N5O3/c1-20-10-8-18-16(20)11-13-3-2-9-21(12-13)17(23)19-14-4-6-15(7-5-14)22(24)25/h4-8,10,13H,2-3,9,11-12H2,1H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | YBZSVIKCYFZSDZ-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|