C19H24ClN5O3 — CID 97066675
(2S)-N-(2-chloro-4-nitrophenyl)-2-[(3R)-3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]propanamide (PubChem CID 97066675) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-nitrophenyl)-2-[(3R)-3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]propanamide.
| Compound Name | (2S)-N-(2-chloro-4-nitrophenyl)-2-[(3R)-3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 97066675 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2S)-N-(2-chloro-4-nitrophenyl)-2-[(3R)-3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)N1CCC[C@H](Cc2nccn2C)C1 |
| InChI | InChI=1S/C19H24ClN5O3/c1-13(19(26)22-17-6-5-15(25(27)28)11-16(17)20)24-8-3-4-14(12-24)10-18-21-7-9-23(18)2/h5-7,9,11,13-14H,3-4,8,10,12H2,1-2H3,(H,22,26)/t13-,14+/m0/s1 |
| InChIKey | PZMRRKWELFZTSM-UONOGXRCSA-N |
| XLogP | 3.26 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|