C19H28ClN5O6S — CID 55601018
N-(2-chloro-4-nitrophenyl)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 55601018) has the molecular formula C19H28ClN5O6S and a molecular weight of 489.98 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55601018 |
| Molecular Formula | C19H28ClN5O6S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | CC1CN(S(=O)(=O)N2CCN(C(C)C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)CC2)CC(C)O1 |
| InChI | InChI=1S/C19H28ClN5O6S/c1-13-11-24(12-14(2)31-13)32(29,30)23-8-6-22(7-9-23)15(3)19(26)21-18-5-4-16(25(27)28)10-17(18)20/h4-5,10,13-15H,6-9,11-12H2,1-3H3,(H,21,26) |
| InChIKey | MVWPOXGSTTYZJG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|