C16H21N3O2S — CID 124589130
[1-[(2S,3R)-2-methyl-3-phenylthiomorpholine-4-carbonyl]cyclopropyl]urea (PubChem CID 124589130) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is [1-[(2S,3R)-2-methyl-3-phenylthiomorpholine-4-carbonyl]cyclopropyl]urea.
| Compound Name | [1-[(2S,3R)-2-methyl-3-phenylthiomorpholine-4-carbonyl]cyclopropyl]urea |
|---|---|
| PubChem CID | 124589130 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [1-[(2S,3R)-2-methyl-3-phenylthiomorpholine-4-carbonyl]cyclopropyl]urea |
| SMILES | C[C@@H]1SCCN(C(=O)C2(NC(N)=O)CC2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11-13(12-5-3-2-4-6-12)19(9-10-22-11)14(20)16(7-8-16)18-15(17)21/h2-6,11,13H,7-10H2,1H3,(H3,17,18,21)/t11-,13-/m0/s1 |
| InChIKey | SSJAOYCEAUVZQS-AAEUAGOBSA-N |
| XLogP | 1.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |