C17H25N3O2S — CID 124567149
[5-[(2R,3S)-2-methyl-3-phenylthiomorpholin-4-yl]-5-oxopentyl]urea (PubChem CID 124567149) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is [5-[(2R,3S)-2-methyl-3-phenylthiomorpholin-4-yl]-5-oxopentyl]urea.
| Compound Name | [5-[(2R,3S)-2-methyl-3-phenylthiomorpholin-4-yl]-5-oxopentyl]urea |
|---|---|
| PubChem CID | 124567149 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [5-[(2R,3S)-2-methyl-3-phenylthiomorpholin-4-yl]-5-oxopentyl]urea |
| SMILES | C[C@H]1SCCN(C(=O)CCCCNC(N)=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H25N3O2S/c1-13-16(14-7-3-2-4-8-14)20(11-12-23-13)15(21)9-5-6-10-19-17(18)22/h2-4,7-8,13,16H,5-6,9-12H2,1H3,(H3,18,19,22)/t13-,16-/m1/s1 |
| InChIKey | KCPHWEVCVXOONX-CZUORRHYSA-N |
| XLogP | 2.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|