C19H30N4O2 — CID 9162651
[6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]urea (PubChem CID 9162651) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is [6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]urea.
| Compound Name | [6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]urea |
|---|---|
| PubChem CID | 9162651 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]urea |
| SMILES | Cc1ccccc1CN1CCN(C(=O)CCCCCNC(N)=O)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-16-7-4-5-8-17(16)15-22-11-13-23(14-12-22)18(24)9-3-2-6-10-21-19(20)25/h4-5,7-8H,2-3,6,9-15H2,1H3,(H3,20,21,25) |
| InChIKey | UKDFDMDVUVRMSO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|