C26H32N4O2S — CID 27841164
3-[6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 27841164) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 3-[6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 27841164 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 3-[6-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | Cc1ccccc1CN1CCN(C(=O)CCCCCn2c(=S)[nH]c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C26H32N4O2S/c1-20-9-4-5-10-21(20)19-28-15-17-29(18-16-28)24(31)13-3-2-8-14-30-25(32)22-11-6-7-12-23(22)27-26(30)33/h4-7,9-12H,2-3,8,13-19H2,1H3,(H,27,33) |
| InChIKey | GQERZZSEAZMJSW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|