C18H23N3O2S — CID 4170830
3-[3-(3,5-dimethylpiperidin-1-yl)-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4170830) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpiperidin-1-yl)-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[3-(3,5-dimethylpiperidin-1-yl)-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4170830 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[3-(3,5-dimethylpiperidin-1-yl)-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CC1CC(C)CN(C(=O)CCn2c(=S)[nH]c3ccccc3c2=O)C1 |
| InChI | InChI=1S/C18H23N3O2S/c1-12-9-13(2)11-20(10-12)16(22)7-8-21-17(23)14-5-3-4-6-15(14)19-18(21)24/h3-6,12-13H,7-11H2,1-2H3,(H,19,24) |
| InChIKey | PSMHPZOKLFVLOE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|