C22H23FN4O4S2 — CID 24552250
3-[3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 24552250) has the molecular formula C22H23FN4O4S2 and a molecular weight of 490.58 g/mol. Its IUPAC name is 3-[3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 24552250 |
| Molecular Formula | C22H23FN4O4S2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 3-[3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-3-oxopropyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=C(CCn1c(=S)[nH]c2ccccc2c1=O)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H23FN4O4S2/c23-16-6-8-17(9-7-16)33(30,31)26-12-3-11-25(14-15-26)20(28)10-13-27-21(29)18-4-1-2-5-19(18)24-22(27)32/h1-2,4-9H,3,10-15H2,(H,24,32) |
| InChIKey | ROPKXMBNBSPPHR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|