C17H18F3NO2 — CID 124592742
2-[(1R)-1-[[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]propyl]phenol (PubChem CID 124592742) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[(1R)-1-[[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]propyl]phenol.
| Compound Name | 2-[(1R)-1-[[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]propyl]phenol |
|---|---|
| PubChem CID | 124592742 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[(1R)-1-[[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]propyl]phenol |
| SMILES | CC[C@@H](N[C@@H](CO)c1cc(F)c(F)c(F)c1)c1ccccc1O |
| InChI | InChI=1S/C17H18F3NO2/c1-2-14(11-5-3-4-6-16(11)23)21-15(9-22)10-7-12(18)17(20)13(19)8-10/h3-8,14-15,21-23H,2,9H2,1H3/t14-,15+/m1/s1 |
| InChIKey | CPESEZYJNYEXHY-CABCVRRESA-N |
| XLogP | 3.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|