About 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol
2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol (PubChem CID 109380236) has the molecular formula C15H14F3NO2
and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol |
| PubChem CID | 109380236 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol |
| SMILES | OCC(NCc1ccccc1O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H14F3NO2/c16-11-5-10(6-12(17)15(11)18)13(8-20)19-7-9-3-1-2-4-14(9)21/h1-6,13,19-21H,7-8H2 |
| InChIKey | BOULHRWIXKDHDP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol?
The IUPAC name of 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol (CID 109380236) is 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol.
What is the SMILES notation for 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol?
The canonical SMILES for 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol is OCC(NCc1ccccc1O)c1cc(F)c(F)c(F)c1.
What is the InChIKey of 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol?
The InChIKey is BOULHRWIXKDHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3NO2/c16-11-5-10(6-12(17)15(11)18)13(8-20)19-7-9-3-1-2-4-14(9)21/h1-6,13,19-21H,7-8H2.
What are the key properties of 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol?
2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol has a molecular weight of 297.28 g/mol, XLogP of 2.63, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]amino]methyl]phenol is sourced from PubChem (CID 109380236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).