C20H24N2O — CID 124595059
2-(4-aminophenyl)-1-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]ethanone (PubChem CID 124595059) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(4-aminophenyl)-1-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124595059 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-(4-aminophenyl)-1-[(2S,4S)-2-methyl-4-(2-methylphenyl)pyrrolidin-1-yl]ethanone |
| SMILES | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)Cc2ccc(N)cc2)C1 |
| InChI | InChI=1S/C20H24N2O/c1-14-5-3-4-6-19(14)17-11-15(2)22(13-17)20(23)12-16-7-9-18(21)10-8-16/h3-10,15,17H,11-13,21H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | WOBYVDBFWKDIRQ-DOTOQJQBSA-N |
| XLogP | 3.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|