C21H26N2O2 — CID 119806064
2-(4-aminophenyl)-1-[2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]ethanone (PubChem CID 119806064) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]ethanone.
| Compound Name | 2-(4-aminophenyl)-1-[2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 119806064 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(4-aminophenyl)-1-[2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]ethanone |
| SMILES | Cc1ccc(C)c(C2CN(C(=O)Cc3ccc(N)cc3)C(C)CO2)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-14-4-5-15(2)19(10-14)20-12-23(16(3)13-25-20)21(24)11-17-6-8-18(22)9-7-17/h4-10,16,20H,11-13,22H2,1-3H3 |
| InChIKey | LSTNXZHWDFTGCL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|