C21H26N2O2 — CID 125120344
3-(2-aminophenyl)-1-[(2S,5R)-5-methyl-2-(2-methylphenyl)morpholin-4-yl]propan-1-one (PubChem CID 125120344) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[(2S,5R)-5-methyl-2-(2-methylphenyl)morpholin-4-yl]propan-1-one.
| Compound Name | 3-(2-aminophenyl)-1-[(2S,5R)-5-methyl-2-(2-methylphenyl)morpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 125120344 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-(2-aminophenyl)-1-[(2S,5R)-5-methyl-2-(2-methylphenyl)morpholin-4-yl]propan-1-one |
| SMILES | Cc1ccccc1[C@H]1CN(C(=O)CCc2ccccc2N)[C@H](C)CO1 |
| InChI | InChI=1S/C21H26N2O2/c1-15-7-3-5-9-18(15)20-13-23(16(2)14-25-20)21(24)12-11-17-8-4-6-10-19(17)22/h3-10,16,20H,11-14,22H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | OZQWNDSUDWMWEM-OXQOHEQNSA-N |
| XLogP | 3.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|