C35H25ClN4O6S — CID 124600418
3-chloro-N-[(2S,4R)-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-6-nitro-N-phenyl-1-benzothiophene-2-carboxamide (PubChem CID 124600418) has the molecular formula C35H25ClN4O6S and a molecular weight of 665.13 g/mol. Its IUPAC name is 3-chloro-N-[(2S,4R)-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-6-nitro-N-phenyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(2S,4R)-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-6-nitro-N-phenyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 124600418 |
| Molecular Formula | C35H25ClN4O6S |
| Molecular Weight | 665.13 g/mol |
| Exact Mass | 664.12 |
| IUPAC Name | 3-chloro-N-[(2S,4R)-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-6-nitro-N-phenyl-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](N(C(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)c2ccccc2)c2ccccc2N1C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H25ClN4O6S/c1-20-17-28(25-13-7-8-14-27(25)38(20)30(41)19-37-33(42)23-11-5-6-12-24(23)34(37)43)39(21-9-3-2-4-10-21)35(44)32-31(36)26-16-15-22(40(45)46)18-29(26)47-32/h2-16,18,20,28H,17,19H2,1H3/t20-,28+/m0/s1 |
| InChIKey | JYVXLXLGVVOETR-WTYVLRPYSA-N |
| XLogP | 7.27 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.13 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|