C33H37N3O4 — CID 98066825
(E)-N-[(2R,4R)-2-methyl-1-octanoyl-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide (PubChem CID 98066825) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is (E)-N-[(2R,4R)-2-methyl-1-octanoyl-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R,4R)-2-methyl-1-octanoyl-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 98066825 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | (E)-N-[(2R,4R)-2-methyl-1-octanoyl-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide |
| SMILES | CCCCCCCC(=O)N1c2ccccc2[C@H](N(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C33H37N3O4/c1-3-4-5-6-10-17-32(37)34-25(2)24-31(29-15-11-12-16-30(29)34)35(27-13-8-7-9-14-27)33(38)23-20-26-18-21-28(22-19-26)36(39)40/h7-9,11-16,18-23,25,31H,3-6,10,17,24H2,1-2H3/b23-20+/t25-,31-/m1/s1 |
| InChIKey | LZJJHYYMFSRZPM-IPCXHYSGSA-N |
| XLogP | 7.87 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|