C35H33N3O4 — CID 92853055
(E)-N-[(2R,4R)-2-methyl-1-(4-propylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide (PubChem CID 92853055) has the molecular formula C35H33N3O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is (E)-N-[(2R,4R)-2-methyl-1-(4-propylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R,4R)-2-methyl-1-(4-propylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 92853055 |
| Molecular Formula | C35H33N3O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | (E)-N-[(2R,4R)-2-methyl-1-(4-propylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]-3-(4-nitrophenyl)-N-phenylprop-2-enamide |
| SMILES | CCCc1ccc(C(=O)N2c3ccccc3[C@H](N(C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)c3ccccc3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C35H33N3O4/c1-3-9-26-14-19-28(20-15-26)35(40)36-25(2)24-33(31-12-7-8-13-32(31)36)37(29-10-5-4-6-11-29)34(39)23-18-27-16-21-30(22-17-27)38(41)42/h4-8,10-23,25,33H,3,9,24H2,1-2H3/b23-18+/t25-,33-/m1/s1 |
| InChIKey | OIAHKRFFTUUJSB-VDFUTYRLSA-N |
| XLogP | 7.77 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|