C18H20N4O3 — CID 124607571
N-(3-methylphenyl)-2-[(3R)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]acetamide (PubChem CID 124607571) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(3R)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(3R)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124607571 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-(3-methylphenyl)-2-[(3R)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)C[C@@H](Cc3cnn(C)c3)C2=O)c1 |
| InChI | InChI=1S/C18H20N4O3/c1-12-4-3-5-15(6-12)20-16(23)11-22-17(24)8-14(18(22)25)7-13-9-19-21(2)10-13/h3-6,9-10,14H,7-8,11H2,1-2H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | PIMUFZUGYNIJOK-CQSZACIVSA-N |
| XLogP | 1.28 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|