4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid

C17H25NO2 — CID 124607931

IUPAC4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid
SMILESCc1cccc([C@H]2CCCCN2CCCC(=O)O)c1C
InChIInChI=1S/C17H25NO2/c1-13-7-5-8-15(14(13)2)16-9-3-4-11-18(16)12-6-10-17(19)20/h5,7-8,16H,3-4,6,9-12H2,1-2H3,(H,19,20)/t16-/m1/s1
InChIKeyYRVJDCDMRHCFMQ-MRXNPFEDSA-N
MW275.39 g/mol
LogP3.70
Rot. Bonds5

About 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid

4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid (PubChem CID 124607931) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid.

Molecular Properties

Compound Name4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid
PubChem CID124607931
Molecular FormulaC17H25NO2
Molecular Weight275.39 g/mol
Exact Mass275.19
IUPAC Name4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid
SMILESCc1cccc([C@H]2CCCCN2CCCC(=O)O)c1C
InChIInChI=1S/C17H25NO2/c1-13-7-5-8-15(14(13)2)16-9-3-4-11-18(16)12-6-10-17(19)20/h5,7-8,16H,3-4,6,9-12H2,1-2H3,(H,19,20)/t16-/m1/s1
InChIKeyYRVJDCDMRHCFMQ-MRXNPFEDSA-N
XLogP3.70
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.39
LogP ≤ 53.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid?
The IUPAC name of 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid (CID 124607931) is 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid.
What is the SMILES notation for 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid?
The canonical SMILES for 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid is Cc1cccc([C@H]2CCCCN2CCCC(=O)O)c1C.
What is the InChIKey of 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid?
The InChIKey is YRVJDCDMRHCFMQ-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H25NO2/c1-13-7-5-8-15(14(13)2)16-9-3-4-11-18(16)12-6-10-17(19)20/h5,7-8,16H,3-4,6,9-12H2,1-2H3,(H,19,20)/t16-/m1/s1.
What are the key properties of 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid?
4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid has a molecular weight of 275.39 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-(2,3-dimethylphenyl)piperidin-1-yl]butanoic acid is sourced from PubChem (CID 124607931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).