About 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile
5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile (PubChem CID 124609421) has the molecular formula C17H15ClN2O2S
and a molecular weight of 346.84 g/mol. Its IUPAC name is 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile |
| PubChem CID | 124609421 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile |
| SMILES | C[C@H]1CO[C@@H](c2ccccc2Cl)CN1C(=O)c1cc(C#N)cs1 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-11-9-22-15(13-4-2-3-5-14(13)18)8-20(11)17(21)16-6-12(7-19)10-23-16/h2-6,10-11,15H,8-9H2,1H3/t11-,15+/m0/s1 |
| InChIKey | NTDPYUYGHSZQBG-XHDPSFHLSA-N |
| XLogP | 3.88 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile?
The IUPAC name of 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile (CID 124609421) is 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile.
What is the SMILES notation for 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile?
The canonical SMILES for 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile is C[C@H]1CO[C@@H](c2ccccc2Cl)CN1C(=O)c1cc(C#N)cs1.
What is the InChIKey of 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile?
The InChIKey is NTDPYUYGHSZQBG-XHDPSFHLSA-N. The full InChI is InChI=1S/C17H15ClN2O2S/c1-11-9-22-15(13-4-2-3-5-14(13)18)8-20(11)17(21)16-6-12(7-19)10-23-16/h2-6,10-11,15H,8-9H2,1H3/t11-,15+/m0/s1.
What are the key properties of 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile?
5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile has a molecular weight of 346.84 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,5S)-2-(2-chlorophenyl)-5-methylmorpholine-4-carbonyl]thiophene-3-carbonitrile is sourced from PubChem (CID 124609421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).