C12H15ClN2O2 — CID 146049310
(2S,5R)-2-(2-chlorophenyl)-5-methylmorpholine-4-carboxamide (PubChem CID 146049310) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is (2S,5R)-2-(2-chlorophenyl)-5-methylmorpholine-4-carboxamide.
| Compound Name | (2S,5R)-2-(2-chlorophenyl)-5-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 146049310 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2S,5R)-2-(2-chlorophenyl)-5-methylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1CO[C@@H](c2ccccc2Cl)CN1C(N)=O |
| InChI | InChI=1S/C12H15ClN2O2/c1-8-7-17-11(6-15(8)12(14)16)9-4-2-3-5-10(9)13/h2-5,8,11H,6-7H2,1H3,(H2,14,16)/t8-,11-/m1/s1 |
| InChIKey | SRFOEMJAIXPPCF-LDYMZIIASA-N |
| XLogP | 2.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |