C16H16N2O4S — CID 124610795
(2R)-4-(2-benzyl-1,3-thiazole-5-carbonyl)morpholine-2-carboxylic acid (PubChem CID 124610795) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is (2R)-4-(2-benzyl-1,3-thiazole-5-carbonyl)morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-(2-benzyl-1,3-thiazole-5-carbonyl)morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 124610795 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (2R)-4-(2-benzyl-1,3-thiazole-5-carbonyl)morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)c2cnc(Cc3ccccc3)s2)CCO1 |
| InChI | InChI=1S/C16H16N2O4S/c19-15(18-6-7-22-12(10-18)16(20)21)13-9-17-14(23-13)8-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2,(H,20,21)/t12-/m1/s1 |
| InChIKey | QXJXGXBIOMPDIC-GFCCVEGCSA-N |
| XLogP | 1.66 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |