C16H16N2O3S — CID 125148041
(2S)-1-(2-benzyl-1,3-thiazole-5-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 125148041) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2S)-1-(2-benzyl-1,3-thiazole-5-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2-benzyl-1,3-thiazole-5-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 125148041 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2S)-1-(2-benzyl-1,3-thiazole-5-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)c1cnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H16N2O3S/c19-15(18-8-4-7-12(18)16(20)21)13-10-17-14(22-13)9-11-5-2-1-3-6-11/h1-3,5-6,10,12H,4,7-9H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | GEIOESFSCNHJGO-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |