C11H12N2O4 — CID 19790874
1-(3-hydroxypyridine-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 19790874) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-(3-hydroxypyridine-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(3-hydroxypyridine-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19790874 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-(3-hydroxypyridine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)c1ncccc1O |
| InChI | InChI=1S/C11H12N2O4/c14-8-4-1-5-12-9(8)10(15)13-6-2-3-7(13)11(16)17/h1,4-5,7,14H,2-3,6H2,(H,16,17) |
| InChIKey | MRKZOJZKWCHBBA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |