C15H21ClN2O2 — CID 124611655
(2S)-1-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-methylphenoxy)propan-1-one (PubChem CID 124611655) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is (2S)-1-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-methylphenoxy)propan-1-one.
| Compound Name | (2S)-1-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-methylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 124611655 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S)-1-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-methylphenoxy)propan-1-one |
| SMILES | Cc1cc(Cl)ccc1O[C@@H](C)C(=O)N1CC[C@@H](CN)C1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-10-7-13(16)3-4-14(10)20-11(2)15(19)18-6-5-12(8-17)9-18/h3-4,7,11-12H,5-6,8-9,17H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | CLYKUIBIIOEOJN-RYUDHWBXSA-N |
| XLogP | 2.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |