C14H19Cl2N3O4 — CID 119487218
1-[3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride (PubChem CID 119487218) has the molecular formula C14H19Cl2N3O4 and a molecular weight of 364.23 g/mol. Its IUPAC name is 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119487218 |
| Molecular Formula | C14H19Cl2N3O4 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride |
| SMILES | CC(Oc1ccc(Cl)cc1[N+](=O)[O-])C(=O)N1CCC(CN)C1.Cl |
| InChI | InChI=1S/C14H18ClN3O4.ClH/c1-9(14(19)17-5-4-10(7-16)8-17)22-13-3-2-11(15)6-12(13)18(20)21;/h2-3,6,9-10H,4-5,7-8,16H2,1H3;1H |
| InChIKey | BCYQJFFXZFHORA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|