C16H20ClN3O4 — CID 119639364
2-(4-chloro-2-nitrophenoxy)-1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propan-1-one (PubChem CID 119639364) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenoxy)-1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propan-1-one.
| Compound Name | 2-(4-chloro-2-nitrophenoxy)-1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propan-1-one |
|---|---|
| PubChem CID | 119639364 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-(4-chloro-2-nitrophenoxy)-1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1[N+](=O)[O-])C(=O)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C16H20ClN3O4/c1-10(24-15-5-2-11(17)8-14(15)20(22)23)16(21)19-7-6-12-3-4-13(9-19)18-12/h2,5,8,10,12-13,18H,3-4,6-7,9H2,1H3 |
| InChIKey | PUAUVTSSQVCWDI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|