C16H22ClN3O4 — CID 120819985
1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(4-chloro-2-nitrophenoxy)propan-1-one (PubChem CID 120819985) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(4-chloro-2-nitrophenoxy)propan-1-one.
| Compound Name | 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(4-chloro-2-nitrophenoxy)propan-1-one |
|---|---|
| PubChem CID | 120819985 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(4-chloro-2-nitrophenoxy)propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1[N+](=O)[O-])C(=O)N1CCC(N)C(C)(C)C1 |
| InChI | InChI=1S/C16H22ClN3O4/c1-10(15(21)19-7-6-14(18)16(2,3)9-19)24-13-5-4-11(17)8-12(13)20(22)23/h4-5,8,10,14H,6-7,9,18H2,1-3H3 |
| InChIKey | UHUNUKHWYVXEIG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|