C16H20N4O3 — CID 124613645
3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(3R)-pyrrolidin-3-yl]propanamide (PubChem CID 124613645) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(3R)-pyrrolidin-3-yl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(3R)-pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 124613645 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(3R)-pyrrolidin-3-yl]propanamide |
| SMILES | CN(C(=O)CCn1c(=O)[nH]c(=O)c2ccccc21)[C@@H]1CCNC1 |
| InChI | InChI=1S/C16H20N4O3/c1-19(11-6-8-17-10-11)14(21)7-9-20-13-5-3-2-4-12(13)15(22)18-16(20)23/h2-5,11,17H,6-10H2,1H3,(H,18,22,23)/t11-/m1/s1 |
| InChIKey | OXTYIWRELSLYRW-LLVKDONJSA-N |
| XLogP | -0.10 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |