C24H28N4O3 — CID 24552041
3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide (PubChem CID 24552041) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 24552041 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)CCn1c(=O)[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O3/c1-26(17-18-9-11-19(12-10-18)27-14-5-2-6-15-27)22(29)13-16-28-21-8-4-3-7-20(21)23(30)25-24(28)31/h3-4,7-12H,2,5-6,13-17H2,1H3,(H,25,30,31) |
| InChIKey | OAVGJQAKFYFGOL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|