About 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide
2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide (PubChem CID 124613687) has the molecular formula C15H18ClN5O
and a molecular weight of 319.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide |
| PubChem CID | 124613687 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide |
| SMILES | Cc1nn(-c2cccc(Cl)c2)nc1C(=O)N(C)[C@@H]1CCNC1 |
| InChI | InChI=1S/C15H18ClN5O/c1-10-14(15(22)20(2)13-6-7-17-9-13)19-21(18-10)12-5-3-4-11(16)8-12/h3-5,8,13,17H,6-7,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | HKQLRXAURIAZIM-CYBMUJFWSA-N |
| XLogP | 1.66 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide?
The IUPAC name of 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide (CID 124613687) is 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide.
What is the SMILES notation for 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide?
The canonical SMILES for 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide is Cc1nn(-c2cccc(Cl)c2)nc1C(=O)N(C)[C@@H]1CCNC1.
What is the InChIKey of 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide?
The InChIKey is HKQLRXAURIAZIM-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H18ClN5O/c1-10-14(15(22)20(2)13-6-7-17-9-13)19-21(18-10)12-5-3-4-11(16)8-12/h3-5,8,13,17H,6-7,9H2,1-2H3/t13-/m1/s1.
What are the key properties of 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide?
2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide has a molecular weight of 319.80 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-N,5-dimethyl-N-[(3R)-pyrrolidin-3-yl]triazole-4-carboxamide is sourced from PubChem (CID 124613687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).