C17H18ClNO3 — CID 124614262
(2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-[(1R)-1-hydroxyethyl]phenyl]methyl]acetamide (PubChem CID 124614262) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-[(1R)-1-hydroxyethyl]phenyl]methyl]acetamide.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-[(1R)-1-hydroxyethyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 124614262 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-hydroxy-N-[[4-[(1R)-1-hydroxyethyl]phenyl]methyl]acetamide |
| SMILES | C[C@@H](O)c1ccc(CNC(=O)[C@H](O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO3/c1-11(20)13-8-6-12(7-9-13)10-19-17(22)16(21)14-4-2-3-5-15(14)18/h2-9,11,16,20-21H,10H2,1H3,(H,19,22)/t11-,16-/m1/s1 |
| InChIKey | CJNFHDBEGXAILO-BDJLRTHQSA-N |
| XLogP | 2.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |