C9H10ClNO2 — CID 23548439
2-(2-chlorophenyl)-2-hydroxy-N-methylacetamide (PubChem CID 23548439) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-hydroxy-N-methylacetamide.
| Compound Name | 2-(2-chlorophenyl)-2-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 23548439 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2-(2-chlorophenyl)-2-hydroxy-N-methylacetamide |
| SMILES | CNC(=O)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C9H10ClNO2/c1-11-9(13)8(12)6-4-2-3-5-7(6)10/h2-5,8,12H,1H3,(H,11,13) |
| InChIKey | KAFWNDULVDJEPZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |