C12H18ClN2O+ — CID 9410215
[(1R)-1-(2-chlorophenyl)ethyl]-[(2S)-1-(methylamino)-1-oxopropan-2-yl]azanium (PubChem CID 9410215) has the molecular formula C12H18ClN2O+ and a molecular weight of 241.74 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl]-[(2S)-1-(methylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl]-[(2S)-1-(methylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9410215 |
| Molecular Formula | C12H18ClN2O+ |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl]-[(2S)-1-(methylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CNC(=O)[C@H](C)[NH2+][C@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C12H17ClN2O/c1-8(15-9(2)12(16)14-3)10-6-4-5-7-11(10)13/h4-9,15H,1-3H3,(H,14,16)/p+1/t8-,9+/m1/s1 |
| InChIKey | PRVFDTVRMFNACD-BDAKNGLRSA-O |
| XLogP | 1.10 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |