C19H20ClF3N3O2+ — CID 7999065
[(1S)-1-(2-chlorophenyl)ethyl]-[(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]azanium (PubChem CID 7999065) has the molecular formula C19H20ClF3N3O2+ and a molecular weight of 414.84 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]azanium |
|---|---|
| PubChem CID | 7999065 |
| Molecular Formula | C19H20ClF3N3O2+ |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]azanium |
| SMILES | C[C@H]([NH2+][C@@H](C)c1ccccc1Cl)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H19ClF3N3O2/c1-10(12-5-3-4-6-13(12)20)25-11(2)19(28)24-9-16(27)26-15-8-7-14(21)17(22)18(15)23/h3-8,10-11,25H,9H2,1-2H3,(H,24,28)(H,26,27)/p+1/t10-,11-/m0/s1 |
| InChIKey | RXXDJDHNPGKHFG-QWRGUYRKSA-O |
| XLogP | 2.53 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|