C17H23FN4O2 — CID 124615432
2-[[(3R)-1-(2-fluorophenyl)piperidin-3-yl]carbamoylamino]-N-prop-2-enylacetamide (PubChem CID 124615432) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[[(3R)-1-(2-fluorophenyl)piperidin-3-yl]carbamoylamino]-N-prop-2-enylacetamide.
| Compound Name | 2-[[(3R)-1-(2-fluorophenyl)piperidin-3-yl]carbamoylamino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 124615432 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[[(3R)-1-(2-fluorophenyl)piperidin-3-yl]carbamoylamino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CNC(=O)N[C@@H]1CCCN(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H23FN4O2/c1-2-9-19-16(23)11-20-17(24)21-13-6-5-10-22(12-13)15-8-4-3-7-14(15)18/h2-4,7-8,13H,1,5-6,9-12H2,(H,19,23)(H2,20,21,24)/t13-/m1/s1 |
| InChIKey | XVFGQGJZPIKGGQ-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|