C18H25FN4O2 — CID 166237838
N'-[1-(2-fluorophenyl)piperidin-3-yl]-N-(pyrrolidin-2-ylmethyl)oxamide (PubChem CID 166237838) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is N'-[1-(2-fluorophenyl)piperidin-3-yl]-N-(pyrrolidin-2-ylmethyl)oxamide.
| Compound Name | N'-[1-(2-fluorophenyl)piperidin-3-yl]-N-(pyrrolidin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 166237838 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N'-[1-(2-fluorophenyl)piperidin-3-yl]-N-(pyrrolidin-2-ylmethyl)oxamide |
| SMILES | O=C(NCC1CCCN1)C(=O)NC1CCCN(c2ccccc2F)C1 |
| InChI | InChI=1S/C18H25FN4O2/c19-15-7-1-2-8-16(15)23-10-4-6-14(12-23)22-18(25)17(24)21-11-13-5-3-9-20-13/h1-2,7-8,13-14,20H,3-6,9-12H2,(H,21,24)(H,22,25) |
| InChIKey | RDLVRICGYVWILV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|