C17H18N6 — CID 124615473
2-[(3R)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine (PubChem CID 124615473) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[(3R)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine.
| Compound Name | 2-[(3R)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 124615473 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(3R)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine |
| SMILES | c1ccc(-c2n[nH]c([C@@H]3CCCN(c4ncccn4)C3)n2)cc1 |
| InChI | InChI=1S/C17H18N6/c1-2-6-13(7-3-1)15-20-16(22-21-15)14-8-4-11-23(12-14)17-18-9-5-10-19-17/h1-3,5-7,9-10,14H,4,8,11-12H2,(H,20,21,22)/t14-/m1/s1 |
| InChIKey | BZQKHKBMOYDNMB-CQSZACIVSA-N |
| XLogP | 2.65 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |