About N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide
N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 124615577) has the molecular formula C16H13F2N3O3
and a molecular weight of 333.29 g/mol. Its IUPAC name is N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide |
| PubChem CID | 124615577 |
| Molecular Formula | C16H13F2N3O3 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC(=O)N(c2c(F)cccc2F)C1)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C16H13F2N3O3/c17-11-2-1-3-12(18)15(11)21-8-10(7-14(21)23)20-16(24)9-4-5-19-13(22)6-9/h1-6,10H,7-8H2,(H,19,22)(H,20,24)/t10-/m1/s1 |
| InChIKey | STDWKGHKJSVFKS-SNVBAGLBSA-N |
| XLogP | 1.19 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide?
The IUPAC name of N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide (CID 124615577) is N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide.
What is the SMILES notation for N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide?
The canonical SMILES for N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide is O=C(N[C@@H]1CC(=O)N(c2c(F)cccc2F)C1)c1cc[nH]c(=O)c1.
What is the InChIKey of N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide?
The InChIKey is STDWKGHKJSVFKS-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H13F2N3O3/c17-11-2-1-3-12(18)15(11)21-8-10(7-14(21)23)20-16(24)9-4-5-19-13(22)6-9/h1-6,10H,7-8H2,(H,19,22)(H,20,24)/t10-/m1/s1.
What are the key properties of N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide?
N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide has a molecular weight of 333.29 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-oxo-1H-pyridine-4-carboxamide is sourced from PubChem (CID 124615577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).