C16H15F2N3O4 — CID 166256591
N-[1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-(2,5-dioxopyrrolidin-3-yl)acetamide (PubChem CID 166256591) has the molecular formula C16H15F2N3O4 and a molecular weight of 351.31 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-(2,5-dioxopyrrolidin-3-yl)acetamide.
| Compound Name | N-[1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-(2,5-dioxopyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 166256591 |
| Molecular Formula | C16H15F2N3O4 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)-5-oxopyrrolidin-3-yl]-2-(2,5-dioxopyrrolidin-3-yl)acetamide |
| SMILES | O=C1CC(CC(=O)NC2CC(=O)N(c3c(F)cccc3F)C2)C(=O)N1 |
| InChI | InChI=1S/C16H15F2N3O4/c17-10-2-1-3-11(18)15(10)21-7-9(6-14(21)24)19-12(22)4-8-5-13(23)20-16(8)25/h1-3,8-9H,4-7H2,(H,19,22)(H,20,23,25) |
| InChIKey | WUAQDTJWWFJLTH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|