C19H17N3O — CID 124615715
3-[(1S)-1-[(5-phenyl-1,2-oxazol-3-yl)methylamino]ethyl]benzonitrile (PubChem CID 124615715) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[(1S)-1-[(5-phenyl-1,2-oxazol-3-yl)methylamino]ethyl]benzonitrile.
| Compound Name | 3-[(1S)-1-[(5-phenyl-1,2-oxazol-3-yl)methylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 124615715 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-[(1S)-1-[(5-phenyl-1,2-oxazol-3-yl)methylamino]ethyl]benzonitrile |
| SMILES | C[C@H](NCc1cc(-c2ccccc2)on1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H17N3O/c1-14(17-9-5-6-15(10-17)12-20)21-13-18-11-19(23-22-18)16-7-3-2-4-8-16/h2-11,14,21H,13H2,1H3/t14-/m0/s1 |
| InChIKey | ZJICPYDNKZJKLC-AWEZNQCLSA-N |
| XLogP | 4.06 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |