C14H20N6O — CID 124616805
1-methyl-1-[(1R)-1-pyridin-2-ylethyl]-3-[3-(triazol-1-yl)propyl]urea (PubChem CID 124616805) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-methyl-1-[(1R)-1-pyridin-2-ylethyl]-3-[3-(triazol-1-yl)propyl]urea.
| Compound Name | 1-methyl-1-[(1R)-1-pyridin-2-ylethyl]-3-[3-(triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 124616805 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-methyl-1-[(1R)-1-pyridin-2-ylethyl]-3-[3-(triazol-1-yl)propyl]urea |
| SMILES | C[C@H](c1ccccn1)N(C)C(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C14H20N6O/c1-12(13-6-3-4-7-15-13)19(2)14(21)16-8-5-10-20-11-9-17-18-20/h3-4,6-7,9,11-12H,5,8,10H2,1-2H3,(H,16,21)/t12-/m1/s1 |
| InChIKey | WKXIIZDEHIQNDH-GFCCVEGCSA-N |
| XLogP | 1.47 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|