C15H26N4O3S — CID 95614918
3-[2-(diethylsulfamoyl)ethyl]-1-methyl-1-[(1S)-1-pyridin-2-ylethyl]urea (PubChem CID 95614918) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is 3-[2-(diethylsulfamoyl)ethyl]-1-methyl-1-[(1S)-1-pyridin-2-ylethyl]urea.
| Compound Name | 3-[2-(diethylsulfamoyl)ethyl]-1-methyl-1-[(1S)-1-pyridin-2-ylethyl]urea |
|---|---|
| PubChem CID | 95614918 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3-[2-(diethylsulfamoyl)ethyl]-1-methyl-1-[(1S)-1-pyridin-2-ylethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)CCNC(=O)N(C)[C@@H](C)c1ccccn1 |
| InChI | InChI=1S/C15H26N4O3S/c1-5-19(6-2)23(21,22)12-11-17-15(20)18(4)13(3)14-9-7-8-10-16-14/h7-10,13H,5-6,11-12H2,1-4H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | AGXMCBNZWSRNGX-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |