C17H25N3O3 — CID 124617188
ethyl 2-[4-[[(3R)-oxolan-3-yl]methyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 124617188) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl 2-[4-[[(3R)-oxolan-3-yl]methyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[4-[[(3R)-oxolan-3-yl]methyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 124617188 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | ethyl 2-[4-[[(3R)-oxolan-3-yl]methyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1N1CCN(C[C@H]2CCOC2)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-23-17(21)15-4-3-6-18-16(15)20-9-7-19(8-10-20)12-14-5-11-22-13-14/h3-4,6,14H,2,5,7-13H2,1H3/t14-/m1/s1 |
| InChIKey | ILEDPFUEKPVTPM-CQSZACIVSA-N |
| XLogP | 1.42 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |